C10H15N3O3 — CID 83013842
2-[(4-methoxy-3-nitrophenyl)methyl]-1,1-dimethylhydrazine (PubChem CID 83013842) has the molecular formula C10H15N3O3 and a molecular weight of 225.25 g/mol. Its IUPAC name is 2-[(4-methoxy-3-nitrophenyl)methyl]-1,1-dimethylhydrazine.
| Compound Name | 2-[(4-methoxy-3-nitrophenyl)methyl]-1,1-dimethylhydrazine |
|---|---|
| PubChem CID | 83013842 |
| Molecular Formula | C10H15N3O3 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.11 |
| IUPAC Name | 2-[(4-methoxy-3-nitrophenyl)methyl]-1,1-dimethylhydrazine |
| SMILES | COc1ccc(CNN(C)C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H15N3O3/c1-12(2)11-7-8-4-5-10(16-3)9(6-8)13(14)15/h4-6,11H,7H2,1-3H3 |
| InChIKey | AKYJOIJDLQQDDL-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 67.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|