C19H10F4N2 — CID 830139
4,5,6,7-tetrafluoro-1,3-diphenylindazole (PubChem CID 830139) has the molecular formula C19H10F4N2 and a molecular weight of 342.30 g/mol. Its IUPAC name is 4,5,6,7-tetrafluoro-1,3-diphenylindazole.
| Compound Name | 4,5,6,7-tetrafluoro-1,3-diphenylindazole |
|---|---|
| PubChem CID | 830139 |
| Molecular Formula | C19H10F4N2 |
| Molecular Weight | 342.30 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | 4,5,6,7-tetrafluoro-1,3-diphenylindazole |
| SMILES | Fc1c(F)c(F)c2c(c(-c3ccccc3)nn2-c2ccccc2)c1F |
| InChI | InChI=1S/C19H10F4N2/c20-14-13-18(11-7-3-1-4-8-11)24-25(12-9-5-2-6-10-12)19(13)17(23)16(22)15(14)21/h1-10H |
| InChIKey | ASUYPKCJDMZYTD-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.30 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|