C10H19N3 — CID 83014587
N-piperidin-1-yl-2,3,4,5-tetrahydropyridin-6-amine (PubChem CID 83014587) has the molecular formula C10H19N3 and a molecular weight of 181.28 g/mol. Its IUPAC name is N-piperidin-1-yl-2,3,4,5-tetrahydropyridin-6-amine.
| Compound Name | N-piperidin-1-yl-2,3,4,5-tetrahydropyridin-6-amine |
|---|---|
| PubChem CID | 83014587 |
| Molecular Formula | C10H19N3 |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.16 |
| IUPAC Name | N-piperidin-1-yl-2,3,4,5-tetrahydropyridin-6-amine |
| SMILES | C1CCN(NC2=NCCCC2)CC1 |
| InChI | InChI=1S/C10H19N3/c1-4-8-13(9-5-1)12-10-6-2-3-7-11-10/h1-9H2,(H,11,12) |
| InChIKey | NUGRQLHBKJISPK-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |