About N-but-3-enyl-2,6-dimethylpiperidin-1-amine
N-but-3-enyl-2,6-dimethylpiperidin-1-amine (PubChem CID 83014606) has the molecular formula C11H22N2
and a molecular weight of 182.31 g/mol. Its IUPAC name is N-but-3-enyl-2,6-dimethylpiperidin-1-amine.
Molecular Properties
| Compound Name | N-but-3-enyl-2,6-dimethylpiperidin-1-amine |
| PubChem CID | 83014606 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | N-but-3-enyl-2,6-dimethylpiperidin-1-amine |
| SMILES | C=CCCNN1C(C)CCCC1C |
| InChI | InChI=1S/C11H22N2/c1-4-5-9-12-13-10(2)7-6-8-11(13)3/h4,10-12H,1,5-9H2,2-3H3 |
| InChIKey | MHBZLCOXWWMRKS-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-but-3-enyl-2,6-dimethylpiperidin-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-but-3-enyl-2,6-dimethylpiperidin-1-amine?
The IUPAC name of N-but-3-enyl-2,6-dimethylpiperidin-1-amine (CID 83014606) is N-but-3-enyl-2,6-dimethylpiperidin-1-amine.
What is the SMILES notation for N-but-3-enyl-2,6-dimethylpiperidin-1-amine?
The canonical SMILES for N-but-3-enyl-2,6-dimethylpiperidin-1-amine is C=CCCNN1C(C)CCCC1C.
What is the InChIKey of N-but-3-enyl-2,6-dimethylpiperidin-1-amine?
The InChIKey is MHBZLCOXWWMRKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2/c1-4-5-9-12-13-10(2)7-6-8-11(13)3/h4,10-12H,1,5-9H2,2-3H3.
What are the key properties of N-but-3-enyl-2,6-dimethylpiperidin-1-amine?
N-but-3-enyl-2,6-dimethylpiperidin-1-amine has a molecular weight of 182.31 g/mol, XLogP of 2.33, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-but-3-enyl-2,6-dimethylpiperidin-1-amine is sourced from PubChem (CID 83014606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).