C13H24N4O2 — CID 83014747
1-butan-2-yl-3-[(4-methylpiperazin-1-yl)amino]pyrrolidine-2,5-dione (PubChem CID 83014747) has the molecular formula C13H24N4O2 and a molecular weight of 268.36 g/mol. Its IUPAC name is 1-butan-2-yl-3-[(4-methylpiperazin-1-yl)amino]pyrrolidine-2,5-dione.
| Compound Name | 1-butan-2-yl-3-[(4-methylpiperazin-1-yl)amino]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 83014747 |
| Molecular Formula | C13H24N4O2 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | 1-butan-2-yl-3-[(4-methylpiperazin-1-yl)amino]pyrrolidine-2,5-dione |
| SMILES | CCC(C)N1C(=O)CC(NN2CCN(C)CC2)C1=O |
| InChI | InChI=1S/C13H24N4O2/c1-4-10(2)17-12(18)9-11(13(17)19)14-16-7-5-15(3)6-8-16/h10-11,14H,4-9H2,1-3H3 |
| InChIKey | WKNASUJSMLCXAW-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|