About N-(3-fluoropropyl)-2,6-dimethylpiperidin-1-amine
N-(3-fluoropropyl)-2,6-dimethylpiperidin-1-amine (PubChem CID 83014822) has the molecular formula C10H21FN2
and a molecular weight of 188.29 g/mol. Its IUPAC name is N-(3-fluoropropyl)-2,6-dimethylpiperidin-1-amine.
Molecular Properties
| Compound Name | N-(3-fluoropropyl)-2,6-dimethylpiperidin-1-amine |
| PubChem CID | 83014822 |
| Molecular Formula | C10H21FN2 |
| Molecular Weight | 188.29 g/mol |
| Exact Mass | 188.17 |
| IUPAC Name | N-(3-fluoropropyl)-2,6-dimethylpiperidin-1-amine |
| SMILES | CC1CCCC(C)N1NCCCF |
| InChI | InChI=1S/C10H21FN2/c1-9-5-3-6-10(2)13(9)12-8-4-7-11/h9-10,12H,3-8H2,1-2H3 |
| InChIKey | CZOOJUPFLBKSIA-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.29 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(3-fluoropropyl)-2,6-dimethylpiperidin-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-fluoropropyl)-2,6-dimethylpiperidin-1-amine?
The IUPAC name of N-(3-fluoropropyl)-2,6-dimethylpiperidin-1-amine (CID 83014822) is N-(3-fluoropropyl)-2,6-dimethylpiperidin-1-amine.
What is the SMILES notation for N-(3-fluoropropyl)-2,6-dimethylpiperidin-1-amine?
The canonical SMILES for N-(3-fluoropropyl)-2,6-dimethylpiperidin-1-amine is CC1CCCC(C)N1NCCCF.
What is the InChIKey of N-(3-fluoropropyl)-2,6-dimethylpiperidin-1-amine?
The InChIKey is CZOOJUPFLBKSIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21FN2/c1-9-5-3-6-10(2)13(9)12-8-4-7-11/h9-10,12H,3-8H2,1-2H3.
What are the key properties of N-(3-fluoropropyl)-2,6-dimethylpiperidin-1-amine?
N-(3-fluoropropyl)-2,6-dimethylpiperidin-1-amine has a molecular weight of 188.29 g/mol, XLogP of 2.11, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-fluoropropyl)-2,6-dimethylpiperidin-1-amine is sourced from PubChem (CID 83014822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).