About 4-methylsulfanyl-2-N-morpholin-4-ylbutane-1,2-diamine
4-methylsulfanyl-2-N-morpholin-4-ylbutane-1,2-diamine (PubChem CID 83015052) has the molecular formula C9H21N3OS
and a molecular weight of 219.35 g/mol. Its IUPAC name is 4-methylsulfanyl-2-N-morpholin-4-ylbutane-1,2-diamine.
Molecular Properties
| Compound Name | 4-methylsulfanyl-2-N-morpholin-4-ylbutane-1,2-diamine |
| PubChem CID | 83015052 |
| Molecular Formula | C9H21N3OS |
| Molecular Weight | 219.35 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | 4-methylsulfanyl-2-N-morpholin-4-ylbutane-1,2-diamine |
| SMILES | CSCCC(CN)NN1CCOCC1 |
| InChI | InChI=1S/C9H21N3OS/c1-14-7-2-9(8-10)11-12-3-5-13-6-4-12/h9,11H,2-8,10H2,1H3 |
| InChIKey | IDMQADBNBHAITO-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.35 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-methylsulfanyl-2-N-morpholin-4-ylbutane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylsulfanyl-2-N-morpholin-4-ylbutane-1,2-diamine?
The IUPAC name of 4-methylsulfanyl-2-N-morpholin-4-ylbutane-1,2-diamine (CID 83015052) is 4-methylsulfanyl-2-N-morpholin-4-ylbutane-1,2-diamine.
What is the SMILES notation for 4-methylsulfanyl-2-N-morpholin-4-ylbutane-1,2-diamine?
The canonical SMILES for 4-methylsulfanyl-2-N-morpholin-4-ylbutane-1,2-diamine is CSCCC(CN)NN1CCOCC1.
What is the InChIKey of 4-methylsulfanyl-2-N-morpholin-4-ylbutane-1,2-diamine?
The InChIKey is IDMQADBNBHAITO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H21N3OS/c1-14-7-2-9(8-10)11-12-3-5-13-6-4-12/h9,11H,2-8,10H2,1H3.
What are the key properties of 4-methylsulfanyl-2-N-morpholin-4-ylbutane-1,2-diamine?
4-methylsulfanyl-2-N-morpholin-4-ylbutane-1,2-diamine has a molecular weight of 219.35 g/mol, XLogP of -0.10, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylsulfanyl-2-N-morpholin-4-ylbutane-1,2-diamine is sourced from PubChem (CID 83015052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).