About 2-(1,3-dioxan-4-ylmethyl)-1,1-dimethylhydrazine
2-(1,3-dioxan-4-ylmethyl)-1,1-dimethylhydrazine (PubChem CID 83015082) has the molecular formula C7H16N2O2
and a molecular weight of 160.22 g/mol. Its IUPAC name is 2-(1,3-dioxan-4-ylmethyl)-1,1-dimethylhydrazine.
Molecular Properties
| Compound Name | 2-(1,3-dioxan-4-ylmethyl)-1,1-dimethylhydrazine |
| PubChem CID | 83015082 |
| Molecular Formula | C7H16N2O2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.12 |
| IUPAC Name | 2-(1,3-dioxan-4-ylmethyl)-1,1-dimethylhydrazine |
| SMILES | CN(C)NCC1CCOCO1 |
| InChI | InChI=1S/C7H16N2O2/c1-9(2)8-5-7-3-4-10-6-11-7/h7-8H,3-6H2,1-2H3 |
| InChIKey | FEXMRLIKFGCOIC-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(1,3-dioxan-4-ylmethyl)-1,1-dimethylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-dioxan-4-ylmethyl)-1,1-dimethylhydrazine?
The IUPAC name of 2-(1,3-dioxan-4-ylmethyl)-1,1-dimethylhydrazine (CID 83015082) is 2-(1,3-dioxan-4-ylmethyl)-1,1-dimethylhydrazine.
What is the SMILES notation for 2-(1,3-dioxan-4-ylmethyl)-1,1-dimethylhydrazine?
The canonical SMILES for 2-(1,3-dioxan-4-ylmethyl)-1,1-dimethylhydrazine is CN(C)NCC1CCOCO1.
What is the InChIKey of 2-(1,3-dioxan-4-ylmethyl)-1,1-dimethylhydrazine?
The InChIKey is FEXMRLIKFGCOIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16N2O2/c1-9(2)8-5-7-3-4-10-6-11-7/h7-8H,3-6H2,1-2H3.
What are the key properties of 2-(1,3-dioxan-4-ylmethyl)-1,1-dimethylhydrazine?
2-(1,3-dioxan-4-ylmethyl)-1,1-dimethylhydrazine has a molecular weight of 160.22 g/mol, XLogP of -0.18, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-dioxan-4-ylmethyl)-1,1-dimethylhydrazine is sourced from PubChem (CID 83015082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).