C9H10FN3 — CID 83015429
4-(2,2-dimethylhydrazinyl)-3-fluorobenzonitrile (PubChem CID 83015429) has the molecular formula C9H10FN3 and a molecular weight of 179.20 g/mol. Its IUPAC name is 4-(2,2-dimethylhydrazinyl)-3-fluorobenzonitrile.
| Compound Name | 4-(2,2-dimethylhydrazinyl)-3-fluorobenzonitrile |
|---|---|
| PubChem CID | 83015429 |
| Molecular Formula | C9H10FN3 |
| Molecular Weight | 179.20 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | 4-(2,2-dimethylhydrazinyl)-3-fluorobenzonitrile |
| SMILES | CN(C)Nc1ccc(C#N)cc1F |
| InChI | InChI=1S/C9H10FN3/c1-13(2)12-9-4-3-7(6-11)5-8(9)10/h3-5,12H,1-2H3 |
| InChIKey | REKUZDNWJSOJES-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.20 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|