C14H30N4 — CID 83015474
2-methyl-N-[[1-(4-methylpiperazin-1-yl)pyrrolidin-3-yl]methyl]propan-2-amine (PubChem CID 83015474) has the molecular formula C14H30N4 and a molecular weight of 254.42 g/mol. Its IUPAC name is 2-methyl-N-[[1-(4-methylpiperazin-1-yl)pyrrolidin-3-yl]methyl]propan-2-amine.
| Compound Name | 2-methyl-N-[[1-(4-methylpiperazin-1-yl)pyrrolidin-3-yl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 83015474 |
| Molecular Formula | C14H30N4 |
| Molecular Weight | 254.42 g/mol |
| Exact Mass | 254.25 |
| IUPAC Name | 2-methyl-N-[[1-(4-methylpiperazin-1-yl)pyrrolidin-3-yl]methyl]propan-2-amine |
| SMILES | CN1CCN(N2CCC(CNC(C)(C)C)C2)CC1 |
| InChI | InChI=1S/C14H30N4/c1-14(2,3)15-11-13-5-6-18(12-13)17-9-7-16(4)8-10-17/h13,15H,5-12H2,1-4H3 |
| InChIKey | ZPAHYKOIILVNDD-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 21.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.42 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |