C14H30N4O — CID 83015947
5-[(2,6-dimethylpiperidin-1-yl)amino]-N'-hydroxy-2,2-dimethylpentanimidamide (PubChem CID 83015947) has the molecular formula C14H30N4O and a molecular weight of 270.42 g/mol. Its IUPAC name is 5-[(2,6-dimethylpiperidin-1-yl)amino]-N'-hydroxy-2,2-dimethylpentanimidamide.
| Compound Name | 5-[(2,6-dimethylpiperidin-1-yl)amino]-N'-hydroxy-2,2-dimethylpentanimidamide |
|---|---|
| PubChem CID | 83015947 |
| Molecular Formula | C14H30N4O |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.24 |
| IUPAC Name | 5-[(2,6-dimethylpiperidin-1-yl)amino]-N'-hydroxy-2,2-dimethylpentanimidamide |
| SMILES | CC1CCCC(C)N1NCCCC(C)(C)C(N)=NO |
| InChI | InChI=1S/C14H30N4O/c1-11-7-5-8-12(2)18(11)16-10-6-9-14(3,4)13(15)17-19/h11-12,16,19H,5-10H2,1-4H3,(H2,15,17) |
| InChIKey | ZGQCLWVYGAPXKH-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 73.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|