C13H28N4O — CID 83016539
4-[(2,6-dimethylpiperidin-1-yl)amino]-N'-hydroxy-2,2-dimethylbutanimidamide (PubChem CID 83016539) has the molecular formula C13H28N4O and a molecular weight of 256.39 g/mol. Its IUPAC name is 4-[(2,6-dimethylpiperidin-1-yl)amino]-N'-hydroxy-2,2-dimethylbutanimidamide.
| Compound Name | 4-[(2,6-dimethylpiperidin-1-yl)amino]-N'-hydroxy-2,2-dimethylbutanimidamide |
|---|---|
| PubChem CID | 83016539 |
| Molecular Formula | C13H28N4O |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.23 |
| IUPAC Name | 4-[(2,6-dimethylpiperidin-1-yl)amino]-N'-hydroxy-2,2-dimethylbutanimidamide |
| SMILES | CC1CCCC(C)N1NCCC(C)(C)C(N)=NO |
| InChI | InChI=1S/C13H28N4O/c1-10-6-5-7-11(2)17(10)15-9-8-13(3,4)12(14)16-18/h10-11,15,18H,5-9H2,1-4H3,(H2,14,16) |
| InChIKey | IMQYFIXKHQBMKM-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 73.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|