C10H13N3O — CID 83016723
2-(2,2-dimethylhydrazinyl)-4-methoxybenzonitrile (PubChem CID 83016723) has the molecular formula C10H13N3O and a molecular weight of 191.23 g/mol. Its IUPAC name is 2-(2,2-dimethylhydrazinyl)-4-methoxybenzonitrile.
| Compound Name | 2-(2,2-dimethylhydrazinyl)-4-methoxybenzonitrile |
|---|---|
| PubChem CID | 83016723 |
| Molecular Formula | C10H13N3O |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | 2-(2,2-dimethylhydrazinyl)-4-methoxybenzonitrile |
| SMILES | COc1ccc(C#N)c(NN(C)C)c1 |
| InChI | InChI=1S/C10H13N3O/c1-13(2)12-10-6-9(14-3)5-4-8(10)7-11/h4-6,12H,1-3H3 |
| InChIKey | DVEHXIPFWQQTLG-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 48.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|