About 2-[1-[(2,2-dimethylhydrazinyl)methyl]cyclopropyl]-N'-hydroxyethanimidamide
2-[1-[(2,2-dimethylhydrazinyl)methyl]cyclopropyl]-N'-hydroxyethanimidamide (PubChem CID 83017020) has the molecular formula C8H18N4O
and a molecular weight of 186.26 g/mol. Its IUPAC name is 2-[1-[(2,2-dimethylhydrazinyl)methyl]cyclopropyl]-N'-hydroxyethanimidamide.
Molecular Properties
| Compound Name | 2-[1-[(2,2-dimethylhydrazinyl)methyl]cyclopropyl]-N'-hydroxyethanimidamide |
| PubChem CID | 83017020 |
| Molecular Formula | C8H18N4O |
| Molecular Weight | 186.26 g/mol |
| Exact Mass | 186.15 |
| IUPAC Name | 2-[1-[(2,2-dimethylhydrazinyl)methyl]cyclopropyl]-N'-hydroxyethanimidamide |
| SMILES | CN(C)NCC1(CC(N)=NO)CC1 |
| InChI | InChI=1S/C8H18N4O/c1-12(2)10-6-8(3-4-8)5-7(9)11-13/h10,13H,3-6H2,1-2H3,(H2,9,11) |
| InChIKey | REDWJOIXJQPPAB-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 73.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.26 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[1-[(2,2-dimethylhydrazinyl)methyl]cyclopropyl]-N'-hydroxyethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-[(2,2-dimethylhydrazinyl)methyl]cyclopropyl]-N'-hydroxyethanimidamide?
The IUPAC name of 2-[1-[(2,2-dimethylhydrazinyl)methyl]cyclopropyl]-N'-hydroxyethanimidamide (CID 83017020) is 2-[1-[(2,2-dimethylhydrazinyl)methyl]cyclopropyl]-N'-hydroxyethanimidamide.
What is the SMILES notation for 2-[1-[(2,2-dimethylhydrazinyl)methyl]cyclopropyl]-N'-hydroxyethanimidamide?
The canonical SMILES for 2-[1-[(2,2-dimethylhydrazinyl)methyl]cyclopropyl]-N'-hydroxyethanimidamide is CN(C)NCC1(CC(N)=NO)CC1.
What is the InChIKey of 2-[1-[(2,2-dimethylhydrazinyl)methyl]cyclopropyl]-N'-hydroxyethanimidamide?
The InChIKey is REDWJOIXJQPPAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N4O/c1-12(2)10-6-8(3-4-8)5-7(9)11-13/h10,13H,3-6H2,1-2H3,(H2,9,11).
What are the key properties of 2-[1-[(2,2-dimethylhydrazinyl)methyl]cyclopropyl]-N'-hydroxyethanimidamide?
2-[1-[(2,2-dimethylhydrazinyl)methyl]cyclopropyl]-N'-hydroxyethanimidamide has a molecular weight of 186.26 g/mol, XLogP of -0.03, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-[(2,2-dimethylhydrazinyl)methyl]cyclopropyl]-N'-hydroxyethanimidamide is sourced from PubChem (CID 83017020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).