About 2-carbamothioyl-N-(2,6-dimethylpiperidin-1-yl)-2-propylpentanamide
2-carbamothioyl-N-(2,6-dimethylpiperidin-1-yl)-2-propylpentanamide (PubChem CID 83017266) has the molecular formula C16H31N3OS
and a molecular weight of 313.51 g/mol. Its IUPAC name is 2-carbamothioyl-N-(2,6-dimethylpiperidin-1-yl)-2-propylpentanamide.
Molecular Properties
| Compound Name | 2-carbamothioyl-N-(2,6-dimethylpiperidin-1-yl)-2-propylpentanamide |
| PubChem CID | 83017266 |
| Molecular Formula | C16H31N3OS |
| Molecular Weight | 313.51 g/mol |
| Exact Mass | 313.22 |
| IUPAC Name | 2-carbamothioyl-N-(2,6-dimethylpiperidin-1-yl)-2-propylpentanamide |
| SMILES | CCCC(CCC)(C(=O)NN1C(C)CCCC1C)C(N)=S |
| InChI | InChI=1S/C16H31N3OS/c1-5-10-16(11-6-2,14(17)21)15(20)18-19-12(3)8-7-9-13(19)4/h12-13H,5-11H2,1-4H3,(H2,17,21)(H,18,20) |
| InChIKey | AESMZDSXEFUFNE-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.51 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-carbamothioyl-N-(2,6-dimethylpiperidin-1-yl)-2-propylpentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-carbamothioyl-N-(2,6-dimethylpiperidin-1-yl)-2-propylpentanamide?
The IUPAC name of 2-carbamothioyl-N-(2,6-dimethylpiperidin-1-yl)-2-propylpentanamide (CID 83017266) is 2-carbamothioyl-N-(2,6-dimethylpiperidin-1-yl)-2-propylpentanamide.
What is the SMILES notation for 2-carbamothioyl-N-(2,6-dimethylpiperidin-1-yl)-2-propylpentanamide?
The canonical SMILES for 2-carbamothioyl-N-(2,6-dimethylpiperidin-1-yl)-2-propylpentanamide is CCCC(CCC)(C(=O)NN1C(C)CCCC1C)C(N)=S.
What is the InChIKey of 2-carbamothioyl-N-(2,6-dimethylpiperidin-1-yl)-2-propylpentanamide?
The InChIKey is AESMZDSXEFUFNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H31N3OS/c1-5-10-16(11-6-2,14(17)21)15(20)18-19-12(3)8-7-9-13(19)4/h12-13H,5-11H2,1-4H3,(H2,17,21)(H,18,20).
What are the key properties of 2-carbamothioyl-N-(2,6-dimethylpiperidin-1-yl)-2-propylpentanamide?
2-carbamothioyl-N-(2,6-dimethylpiperidin-1-yl)-2-propylpentanamide has a molecular weight of 313.51 g/mol, XLogP of 3.15, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-carbamothioyl-N-(2,6-dimethylpiperidin-1-yl)-2-propylpentanamide is sourced from PubChem (CID 83017266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).