C6H13N3S — CID 83017492
2-(5,6-dihydro-4H-1,3-thiazin-2-yl)-1,1-dimethylhydrazine (PubChem CID 83017492) has the molecular formula C6H13N3S and a molecular weight of 159.26 g/mol. Its IUPAC name is 2-(5,6-dihydro-4H-1,3-thiazin-2-yl)-1,1-dimethylhydrazine.
| Compound Name | 2-(5,6-dihydro-4H-1,3-thiazin-2-yl)-1,1-dimethylhydrazine |
|---|---|
| PubChem CID | 83017492 |
| Molecular Formula | C6H13N3S |
| Molecular Weight | 159.26 g/mol |
| Exact Mass | 159.08 |
| IUPAC Name | 2-(5,6-dihydro-4H-1,3-thiazin-2-yl)-1,1-dimethylhydrazine |
| SMILES | CN(C)NC1=NCCCS1 |
| InChI | InChI=1S/C6H13N3S/c1-9(2)8-6-7-4-3-5-10-6/h3-5H2,1-2H3,(H,7,8) |
| InChIKey | DWCPXYVKKULBLQ-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.26 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|