C10H14N4 — CID 83017594
1-N,1-N,7-trimethylbenzimidazole-1,2-diamine (PubChem CID 83017594) has the molecular formula C10H14N4 and a molecular weight of 190.25 g/mol. Its IUPAC name is 1-N,1-N,7-trimethylbenzimidazole-1,2-diamine.
| Compound Name | 1-N,1-N,7-trimethylbenzimidazole-1,2-diamine |
|---|---|
| PubChem CID | 83017594 |
| Molecular Formula | C10H14N4 |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | 1-N,1-N,7-trimethylbenzimidazole-1,2-diamine |
| SMILES | Cc1cccc2nc(N)n(N(C)C)c12 |
| InChI | InChI=1S/C10H14N4/c1-7-5-4-6-8-9(7)14(13(2)3)10(11)12-8/h4-6H,1-3H3,(H2,11,12) |
| InChIKey | DYKQEGLOUMMBIH-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |