C8H17N3S — CID 83017609
1,1-dimethyl-2-[(4S)-4-propan-2-yl-4,5-dihydro-1,3-thiazol-2-yl]hydrazine (PubChem CID 83017609) has the molecular formula C8H17N3S and a molecular weight of 187.31 g/mol. Its IUPAC name is 1,1-dimethyl-2-[(4S)-4-propan-2-yl-4,5-dihydro-1,3-thiazol-2-yl]hydrazine.
| Compound Name | 1,1-dimethyl-2-[(4S)-4-propan-2-yl-4,5-dihydro-1,3-thiazol-2-yl]hydrazine |
|---|---|
| PubChem CID | 83017609 |
| Molecular Formula | C8H17N3S |
| Molecular Weight | 187.31 g/mol |
| Exact Mass | 187.11 |
| IUPAC Name | 1,1-dimethyl-2-[(4S)-4-propan-2-yl-4,5-dihydro-1,3-thiazol-2-yl]hydrazine |
| SMILES | CC(C)[C@H]1CSC(NN(C)C)=N1 |
| InChI | InChI=1S/C8H17N3S/c1-6(2)7-5-12-8(9-7)10-11(3)4/h6-7H,5H2,1-4H3,(H,9,10)/t7-/m1/s1 |
| InChIKey | SANBMMFZFYTISW-SSDOTTSWSA-N |
| XLogP | 1.18 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.31 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|