C8H15N3O4 — CID 83017669
4-(dimethylaminocarbamoyl)morpholine-3-carboxylic acid (PubChem CID 83017669) has the molecular formula C8H15N3O4 and a molecular weight of 217.22 g/mol. Its IUPAC name is 4-(dimethylaminocarbamoyl)morpholine-3-carboxylic acid.
| Compound Name | 4-(dimethylaminocarbamoyl)morpholine-3-carboxylic acid |
|---|---|
| PubChem CID | 83017669 |
| Molecular Formula | C8H15N3O4 |
| Molecular Weight | 217.22 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | 4-(dimethylaminocarbamoyl)morpholine-3-carboxylic acid |
| SMILES | CN(C)NC(=O)N1CCOCC1C(=O)O |
| InChI | InChI=1S/C8H15N3O4/c1-10(2)9-8(14)11-3-4-15-5-6(11)7(12)13/h6H,3-5H2,1-2H3,(H,9,14)(H,12,13) |
| InChIKey | BXDMUSVGHLYRLF-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.22 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|