C12H15ClN4O — CID 83018013
4-[2-(1-chloroethyl)imidazo[4,5-b]pyridin-3-yl]morpholine (PubChem CID 83018013) has the molecular formula C12H15ClN4O and a molecular weight of 266.73 g/mol. Its IUPAC name is 4-[2-(1-chloroethyl)imidazo[4,5-b]pyridin-3-yl]morpholine.
| Compound Name | 4-[2-(1-chloroethyl)imidazo[4,5-b]pyridin-3-yl]morpholine |
|---|---|
| PubChem CID | 83018013 |
| Molecular Formula | C12H15ClN4O |
| Molecular Weight | 266.73 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 4-[2-(1-chloroethyl)imidazo[4,5-b]pyridin-3-yl]morpholine |
| SMILES | CC(Cl)c1nc2cccnc2n1N1CCOCC1 |
| InChI | InChI=1S/C12H15ClN4O/c1-9(13)11-15-10-3-2-4-14-12(10)17(11)16-5-7-18-8-6-16/h2-4,9H,5-8H2,1H3 |
| InChIKey | ULZOMVWXTGXRGY-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.73 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|