About 2-(1-chloroethyl)-1-piperidin-1-ylimidazo[4,5-c]pyridine
2-(1-chloroethyl)-1-piperidin-1-ylimidazo[4,5-c]pyridine (PubChem CID 83018634) has the molecular formula C13H17ClN4
and a molecular weight of 264.76 g/mol. Its IUPAC name is 2-(1-chloroethyl)-1-piperidin-1-ylimidazo[4,5-c]pyridine.
Molecular Properties
| Compound Name | 2-(1-chloroethyl)-1-piperidin-1-ylimidazo[4,5-c]pyridine |
| PubChem CID | 83018634 |
| Molecular Formula | C13H17ClN4 |
| Molecular Weight | 264.76 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | 2-(1-chloroethyl)-1-piperidin-1-ylimidazo[4,5-c]pyridine |
| SMILES | CC(Cl)c1nc2cnccc2n1N1CCCCC1 |
| InChI | InChI=1S/C13H17ClN4/c1-10(14)13-16-11-9-15-6-5-12(11)18(13)17-7-3-2-4-8-17/h5-6,9-10H,2-4,7-8H2,1H3 |
| InChIKey | VCMUALBPLUYVCQ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.76 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-chloroethyl)-1-piperidin-1-ylimidazo[4,5-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-chloroethyl)-1-piperidin-1-ylimidazo[4,5-c]pyridine?
The IUPAC name of 2-(1-chloroethyl)-1-piperidin-1-ylimidazo[4,5-c]pyridine (CID 83018634) is 2-(1-chloroethyl)-1-piperidin-1-ylimidazo[4,5-c]pyridine.
What is the SMILES notation for 2-(1-chloroethyl)-1-piperidin-1-ylimidazo[4,5-c]pyridine?
The canonical SMILES for 2-(1-chloroethyl)-1-piperidin-1-ylimidazo[4,5-c]pyridine is CC(Cl)c1nc2cnccc2n1N1CCCCC1.
What is the InChIKey of 2-(1-chloroethyl)-1-piperidin-1-ylimidazo[4,5-c]pyridine?
The InChIKey is VCMUALBPLUYVCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17ClN4/c1-10(14)13-16-11-9-15-6-5-12(11)18(13)17-7-3-2-4-8-17/h5-6,9-10H,2-4,7-8H2,1H3.
What are the key properties of 2-(1-chloroethyl)-1-piperidin-1-ylimidazo[4,5-c]pyridine?
2-(1-chloroethyl)-1-piperidin-1-ylimidazo[4,5-c]pyridine has a molecular weight of 264.76 g/mol, XLogP of 2.85, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-chloroethyl)-1-piperidin-1-ylimidazo[4,5-c]pyridine is sourced from PubChem (CID 83018634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).