C14H19ClN4 — CID 83018887
6-chloro-1-(2,6-dimethylpiperidin-1-yl)benzimidazol-2-amine (PubChem CID 83018887) has the molecular formula C14H19ClN4 and a molecular weight of 278.79 g/mol. Its IUPAC name is 6-chloro-1-(2,6-dimethylpiperidin-1-yl)benzimidazol-2-amine.
| Compound Name | 6-chloro-1-(2,6-dimethylpiperidin-1-yl)benzimidazol-2-amine |
|---|---|
| PubChem CID | 83018887 |
| Molecular Formula | C14H19ClN4 |
| Molecular Weight | 278.79 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 6-chloro-1-(2,6-dimethylpiperidin-1-yl)benzimidazol-2-amine |
| SMILES | CC1CCCC(C)N1n1c(N)nc2ccc(Cl)cc21 |
| InChI | InChI=1S/C14H19ClN4/c1-9-4-3-5-10(2)18(9)19-13-8-11(15)6-7-12(13)17-14(19)16/h6-10H,3-5H2,1-2H3,(H2,16,17) |
| InChIKey | JZONPCZGOGCAFI-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.79 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |