C8H15N3S — CID 83019299
2-(5-cyclopropyl-4,5-dihydro-1,3-thiazol-2-yl)-1,1-dimethylhydrazine (PubChem CID 83019299) has the molecular formula C8H15N3S and a molecular weight of 185.30 g/mol. Its IUPAC name is 2-(5-cyclopropyl-4,5-dihydro-1,3-thiazol-2-yl)-1,1-dimethylhydrazine.
| Compound Name | 2-(5-cyclopropyl-4,5-dihydro-1,3-thiazol-2-yl)-1,1-dimethylhydrazine |
|---|---|
| PubChem CID | 83019299 |
| Molecular Formula | C8H15N3S |
| Molecular Weight | 185.30 g/mol |
| Exact Mass | 185.10 |
| IUPAC Name | 2-(5-cyclopropyl-4,5-dihydro-1,3-thiazol-2-yl)-1,1-dimethylhydrazine |
| SMILES | CN(C)NC1=NCC(C2CC2)S1 |
| InChI | InChI=1S/C8H15N3S/c1-11(2)10-8-9-5-7(12-8)6-3-4-6/h6-7H,3-5H2,1-2H3,(H,9,10) |
| InChIKey | SGHRZZKZWXOERA-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.30 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|