C10H19N3O3 — CID 83019357
2-[1-[(dimethylaminocarbamoylamino)methyl]cyclobutyl]acetic acid (PubChem CID 83019357) has the molecular formula C10H19N3O3 and a molecular weight of 229.28 g/mol. Its IUPAC name is 2-[1-[(dimethylaminocarbamoylamino)methyl]cyclobutyl]acetic acid.
| Compound Name | 2-[1-[(dimethylaminocarbamoylamino)methyl]cyclobutyl]acetic acid |
|---|---|
| PubChem CID | 83019357 |
| Molecular Formula | C10H19N3O3 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.14 |
| IUPAC Name | 2-[1-[(dimethylaminocarbamoylamino)methyl]cyclobutyl]acetic acid |
| SMILES | CN(C)NC(=O)NCC1(CC(=O)O)CCC1 |
| InChI | InChI=1S/C10H19N3O3/c1-13(2)12-9(16)11-7-10(4-3-5-10)6-8(14)15/h3-7H2,1-2H3,(H,14,15)(H2,11,12,16) |
| InChIKey | GHFUFXJKDKSTGS-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|