About 2-[[(2,6-dimethylpiperidin-1-yl)carbamoylamino]methyl]-3-methylbutanoic acid
2-[[(2,6-dimethylpiperidin-1-yl)carbamoylamino]methyl]-3-methylbutanoic acid (PubChem CID 83019501) has the molecular formula C14H27N3O3
and a molecular weight of 285.39 g/mol. Its IUPAC name is 2-[[(2,6-dimethylpiperidin-1-yl)carbamoylamino]methyl]-3-methylbutanoic acid.
Molecular Properties
| Compound Name | 2-[[(2,6-dimethylpiperidin-1-yl)carbamoylamino]methyl]-3-methylbutanoic acid |
| PubChem CID | 83019501 |
| Molecular Formula | C14H27N3O3 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.21 |
| IUPAC Name | 2-[[(2,6-dimethylpiperidin-1-yl)carbamoylamino]methyl]-3-methylbutanoic acid |
| SMILES | CC(C)C(CNC(=O)NN1C(C)CCCC1C)C(=O)O |
| InChI | InChI=1S/C14H27N3O3/c1-9(2)12(13(18)19)8-15-14(20)16-17-10(3)6-5-7-11(17)4/h9-12H,5-8H2,1-4H3,(H,18,19)(H2,15,16,20) |
| InChIKey | MYGMEZIUIZIVFW-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[[(2,6-dimethylpiperidin-1-yl)carbamoylamino]methyl]-3-methylbutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(2,6-dimethylpiperidin-1-yl)carbamoylamino]methyl]-3-methylbutanoic acid?
The IUPAC name of 2-[[(2,6-dimethylpiperidin-1-yl)carbamoylamino]methyl]-3-methylbutanoic acid (CID 83019501) is 2-[[(2,6-dimethylpiperidin-1-yl)carbamoylamino]methyl]-3-methylbutanoic acid.
What is the SMILES notation for 2-[[(2,6-dimethylpiperidin-1-yl)carbamoylamino]methyl]-3-methylbutanoic acid?
The canonical SMILES for 2-[[(2,6-dimethylpiperidin-1-yl)carbamoylamino]methyl]-3-methylbutanoic acid is CC(C)C(CNC(=O)NN1C(C)CCCC1C)C(=O)O.
What is the InChIKey of 2-[[(2,6-dimethylpiperidin-1-yl)carbamoylamino]methyl]-3-methylbutanoic acid?
The InChIKey is MYGMEZIUIZIVFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27N3O3/c1-9(2)12(13(18)19)8-15-14(20)16-17-10(3)6-5-7-11(17)4/h9-12H,5-8H2,1-4H3,(H,18,19)(H2,15,16,20).
What are the key properties of 2-[[(2,6-dimethylpiperidin-1-yl)carbamoylamino]methyl]-3-methylbutanoic acid?
2-[[(2,6-dimethylpiperidin-1-yl)carbamoylamino]methyl]-3-methylbutanoic acid has a molecular weight of 285.39 g/mol, XLogP of 1.82, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(2,6-dimethylpiperidin-1-yl)carbamoylamino]methyl]-3-methylbutanoic acid is sourced from PubChem (CID 83019501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).