C8H11Cl2N5 — CID 83020030
3,6-dichloro-N-piperidin-1-yl-1,2,4-triazin-5-amine (PubChem CID 83020030) has the molecular formula C8H11Cl2N5 and a molecular weight of 248.12 g/mol. Its IUPAC name is 3,6-dichloro-N-piperidin-1-yl-1,2,4-triazin-5-amine.
| Compound Name | 3,6-dichloro-N-piperidin-1-yl-1,2,4-triazin-5-amine |
|---|---|
| PubChem CID | 83020030 |
| Molecular Formula | C8H11Cl2N5 |
| Molecular Weight | 248.12 g/mol |
| Exact Mass | 247.04 |
| IUPAC Name | 3,6-dichloro-N-piperidin-1-yl-1,2,4-triazin-5-amine |
| SMILES | Clc1nnc(Cl)c(NN2CCCCC2)n1 |
| InChI | InChI=1S/C8H11Cl2N5/c9-6-7(11-8(10)13-12-6)14-15-4-2-1-3-5-15/h1-5H2,(H,11,13,14) |
| InChIKey | MHIFWWACVWFJSK-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.12 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |