C11H23N3O — CID 83020995
N-(2,6-dimethylpiperidin-1-yl)-2-(ethylamino)acetamide (PubChem CID 83020995) has the molecular formula C11H23N3O and a molecular weight of 213.32 g/mol. Its IUPAC name is N-(2,6-dimethylpiperidin-1-yl)-2-(ethylamino)acetamide.
| Compound Name | N-(2,6-dimethylpiperidin-1-yl)-2-(ethylamino)acetamide |
|---|---|
| PubChem CID | 83020995 |
| Molecular Formula | C11H23N3O |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.18 |
| IUPAC Name | N-(2,6-dimethylpiperidin-1-yl)-2-(ethylamino)acetamide |
| SMILES | CCNCC(=O)NN1C(C)CCCC1C |
| InChI | InChI=1S/C11H23N3O/c1-4-12-8-11(15)13-14-9(2)6-5-7-10(14)3/h9-10,12H,4-8H2,1-3H3,(H,13,15) |
| InChIKey | MHSFQRGVMDFYTC-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |