About N-(2,2-difluoroethyl)-2,6-dimethylpiperidin-1-amine
N-(2,2-difluoroethyl)-2,6-dimethylpiperidin-1-amine (PubChem CID 83021009) has the molecular formula C9H18F2N2
and a molecular weight of 192.25 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-2,6-dimethylpiperidin-1-amine.
Molecular Properties
| Compound Name | N-(2,2-difluoroethyl)-2,6-dimethylpiperidin-1-amine |
| PubChem CID | 83021009 |
| Molecular Formula | C9H18F2N2 |
| Molecular Weight | 192.25 g/mol |
| Exact Mass | 192.14 |
| IUPAC Name | N-(2,2-difluoroethyl)-2,6-dimethylpiperidin-1-amine |
| SMILES | CC1CCCC(C)N1NCC(F)F |
| InChI | InChI=1S/C9H18F2N2/c1-7-4-3-5-8(2)13(7)12-6-9(10)11/h7-9,12H,3-6H2,1-2H3 |
| InChIKey | YGCBYCGGRCNXQO-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.25 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(2,2-difluoroethyl)-2,6-dimethylpiperidin-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,2-difluoroethyl)-2,6-dimethylpiperidin-1-amine?
The IUPAC name of N-(2,2-difluoroethyl)-2,6-dimethylpiperidin-1-amine (CID 83021009) is N-(2,2-difluoroethyl)-2,6-dimethylpiperidin-1-amine.
What is the SMILES notation for N-(2,2-difluoroethyl)-2,6-dimethylpiperidin-1-amine?
The canonical SMILES for N-(2,2-difluoroethyl)-2,6-dimethylpiperidin-1-amine is CC1CCCC(C)N1NCC(F)F.
What is the InChIKey of N-(2,2-difluoroethyl)-2,6-dimethylpiperidin-1-amine?
The InChIKey is YGCBYCGGRCNXQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18F2N2/c1-7-4-3-5-8(2)13(7)12-6-9(10)11/h7-9,12H,3-6H2,1-2H3.
What are the key properties of N-(2,2-difluoroethyl)-2,6-dimethylpiperidin-1-amine?
N-(2,2-difluoroethyl)-2,6-dimethylpiperidin-1-amine has a molecular weight of 192.25 g/mol, XLogP of 2.02, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,2-difluoroethyl)-2,6-dimethylpiperidin-1-amine is sourced from PubChem (CID 83021009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).