About 2-amino-N-(2,6-dimethylpiperidin-1-yl)pent-4-enamide
2-amino-N-(2,6-dimethylpiperidin-1-yl)pent-4-enamide (PubChem CID 83021114) has the molecular formula C12H23N3O
and a molecular weight of 225.34 g/mol. Its IUPAC name is 2-amino-N-(2,6-dimethylpiperidin-1-yl)pent-4-enamide.
Molecular Properties
| Compound Name | 2-amino-N-(2,6-dimethylpiperidin-1-yl)pent-4-enamide |
| PubChem CID | 83021114 |
| Molecular Formula | C12H23N3O |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.18 |
| IUPAC Name | 2-amino-N-(2,6-dimethylpiperidin-1-yl)pent-4-enamide |
| SMILES | C=CCC(N)C(=O)NN1C(C)CCCC1C |
| InChI | InChI=1S/C12H23N3O/c1-4-6-11(13)12(16)14-15-9(2)7-5-8-10(15)3/h4,9-11H,1,5-8,13H2,2-3H3,(H,14,16) |
| InChIKey | MBGPYEBQZAQSBX-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-N-(2,6-dimethylpiperidin-1-yl)pent-4-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N-(2,6-dimethylpiperidin-1-yl)pent-4-enamide?
The IUPAC name of 2-amino-N-(2,6-dimethylpiperidin-1-yl)pent-4-enamide (CID 83021114) is 2-amino-N-(2,6-dimethylpiperidin-1-yl)pent-4-enamide.
What is the SMILES notation for 2-amino-N-(2,6-dimethylpiperidin-1-yl)pent-4-enamide?
The canonical SMILES for 2-amino-N-(2,6-dimethylpiperidin-1-yl)pent-4-enamide is C=CCC(N)C(=O)NN1C(C)CCCC1C.
What is the InChIKey of 2-amino-N-(2,6-dimethylpiperidin-1-yl)pent-4-enamide?
The InChIKey is MBGPYEBQZAQSBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23N3O/c1-4-6-11(13)12(16)14-15-9(2)7-5-8-10(15)3/h4,9-11H,1,5-8,13H2,2-3H3,(H,14,16).
What are the key properties of 2-amino-N-(2,6-dimethylpiperidin-1-yl)pent-4-enamide?
2-amino-N-(2,6-dimethylpiperidin-1-yl)pent-4-enamide has a molecular weight of 225.34 g/mol, XLogP of 1.18, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N-(2,6-dimethylpiperidin-1-yl)pent-4-enamide is sourced from PubChem (CID 83021114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).