About N-piperidin-1-yl-1H-1,2,4-triazole-5-carboxamide
N-piperidin-1-yl-1H-1,2,4-triazole-5-carboxamide (PubChem CID 83022777) has the molecular formula C8H13N5O
and a molecular weight of 195.23 g/mol. Its IUPAC name is N-piperidin-1-yl-1H-1,2,4-triazole-5-carboxamide.
Molecular Properties
| Compound Name | N-piperidin-1-yl-1H-1,2,4-triazole-5-carboxamide |
| PubChem CID | 83022777 |
| Molecular Formula | C8H13N5O |
| Molecular Weight | 195.23 g/mol |
| Exact Mass | 195.11 |
| IUPAC Name | N-piperidin-1-yl-1H-1,2,4-triazole-5-carboxamide |
| SMILES | O=C(NN1CCCCC1)c1ncn[nH]1 |
| InChI | InChI=1S/C8H13N5O/c14-8(7-9-6-10-11-7)12-13-4-2-1-3-5-13/h6H,1-5H2,(H,12,14)(H,9,10,11) |
| InChIKey | ANXZGVAVDLVFDY-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.23 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-piperidin-1-yl-1H-1,2,4-triazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-piperidin-1-yl-1H-1,2,4-triazole-5-carboxamide?
The IUPAC name of N-piperidin-1-yl-1H-1,2,4-triazole-5-carboxamide (CID 83022777) is N-piperidin-1-yl-1H-1,2,4-triazole-5-carboxamide.
What is the SMILES notation for N-piperidin-1-yl-1H-1,2,4-triazole-5-carboxamide?
The canonical SMILES for N-piperidin-1-yl-1H-1,2,4-triazole-5-carboxamide is O=C(NN1CCCCC1)c1ncn[nH]1.
What is the InChIKey of N-piperidin-1-yl-1H-1,2,4-triazole-5-carboxamide?
The InChIKey is ANXZGVAVDLVFDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N5O/c14-8(7-9-6-10-11-7)12-13-4-2-1-3-5-13/h6H,1-5H2,(H,12,14)(H,9,10,11).
What are the key properties of N-piperidin-1-yl-1H-1,2,4-triazole-5-carboxamide?
N-piperidin-1-yl-1H-1,2,4-triazole-5-carboxamide has a molecular weight of 195.23 g/mol, XLogP of -0.06, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-piperidin-1-yl-1H-1,2,4-triazole-5-carboxamide is sourced from PubChem (CID 83022777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).