About 3-amino-N',N',5-trimethyl-1H-pyrazole-4-carbohydrazide
3-amino-N',N',5-trimethyl-1H-pyrazole-4-carbohydrazide (PubChem CID 83023624) has the molecular formula C7H13N5O
and a molecular weight of 183.22 g/mol. Its IUPAC name is 3-amino-N',N',5-trimethyl-1H-pyrazole-4-carbohydrazide.
Molecular Properties
| Compound Name | 3-amino-N',N',5-trimethyl-1H-pyrazole-4-carbohydrazide |
| PubChem CID | 83023624 |
| Molecular Formula | C7H13N5O |
| Molecular Weight | 183.22 g/mol |
| Exact Mass | 183.11 |
| IUPAC Name | 3-amino-N',N',5-trimethyl-1H-pyrazole-4-carbohydrazide |
| SMILES | Cc1[nH]nc(N)c1C(=O)NN(C)C |
| InChI | InChI=1S/C7H13N5O/c1-4-5(6(8)10-9-4)7(13)11-12(2)3/h1-3H3,(H,11,13)(H3,8,9,10) |
| InChIKey | ZCYYWMRVDDTXPJ-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 87.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.22 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-N',N',5-trimethyl-1H-pyrazole-4-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-N',N',5-trimethyl-1H-pyrazole-4-carbohydrazide?
The IUPAC name of 3-amino-N',N',5-trimethyl-1H-pyrazole-4-carbohydrazide (CID 83023624) is 3-amino-N',N',5-trimethyl-1H-pyrazole-4-carbohydrazide.
What is the SMILES notation for 3-amino-N',N',5-trimethyl-1H-pyrazole-4-carbohydrazide?
The canonical SMILES for 3-amino-N',N',5-trimethyl-1H-pyrazole-4-carbohydrazide is Cc1[nH]nc(N)c1C(=O)NN(C)C.
What is the InChIKey of 3-amino-N',N',5-trimethyl-1H-pyrazole-4-carbohydrazide?
The InChIKey is ZCYYWMRVDDTXPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N5O/c1-4-5(6(8)10-9-4)7(13)11-12(2)3/h1-3H3,(H,11,13)(H3,8,9,10).
What are the key properties of 3-amino-N',N',5-trimethyl-1H-pyrazole-4-carbohydrazide?
3-amino-N',N',5-trimethyl-1H-pyrazole-4-carbohydrazide has a molecular weight of 183.22 g/mol, XLogP of -0.49, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-N',N',5-trimethyl-1H-pyrazole-4-carbohydrazide is sourced from PubChem (CID 83023624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).