C14H22N4O — CID 83023670
2-amino-5-[(2,6-dimethylpiperidin-1-yl)amino]benzamide (PubChem CID 83023670) has the molecular formula C14H22N4O and a molecular weight of 262.36 g/mol. Its IUPAC name is 2-amino-5-[(2,6-dimethylpiperidin-1-yl)amino]benzamide.
| Compound Name | 2-amino-5-[(2,6-dimethylpiperidin-1-yl)amino]benzamide |
|---|---|
| PubChem CID | 83023670 |
| Molecular Formula | C14H22N4O |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | 2-amino-5-[(2,6-dimethylpiperidin-1-yl)amino]benzamide |
| SMILES | CC1CCCC(C)N1Nc1ccc(N)c(C(N)=O)c1 |
| InChI | InChI=1S/C14H22N4O/c1-9-4-3-5-10(2)18(9)17-11-6-7-13(15)12(8-11)14(16)19/h6-10,17H,3-5,15H2,1-2H3,(H2,16,19) |
| InChIKey | KRMNOPCYOIMZMS-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 84.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|