About 1-(dimethylamino)-6,7-dihydro-5H-indol-4-one
1-(dimethylamino)-6,7-dihydro-5H-indol-4-one (PubChem CID 83023680) has the molecular formula C10H14N2O
and a molecular weight of 178.24 g/mol. Its IUPAC name is 1-(dimethylamino)-6,7-dihydro-5H-indol-4-one.
Molecular Properties
| Compound Name | 1-(dimethylamino)-6,7-dihydro-5H-indol-4-one |
| PubChem CID | 83023680 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.24 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | 1-(dimethylamino)-6,7-dihydro-5H-indol-4-one |
| SMILES | CN(C)n1ccc2c1CCCC2=O |
| InChI | InChI=1S/C10H14N2O/c1-11(2)12-7-6-8-9(12)4-3-5-10(8)13/h6-7H,3-5H2,1-2H3 |
| InChIKey | LLATTXKETJPRRE-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.24 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(dimethylamino)-6,7-dihydro-5H-indol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(dimethylamino)-6,7-dihydro-5H-indol-4-one?
The IUPAC name of 1-(dimethylamino)-6,7-dihydro-5H-indol-4-one (CID 83023680) is 1-(dimethylamino)-6,7-dihydro-5H-indol-4-one.
What is the SMILES notation for 1-(dimethylamino)-6,7-dihydro-5H-indol-4-one?
The canonical SMILES for 1-(dimethylamino)-6,7-dihydro-5H-indol-4-one is CN(C)n1ccc2c1CCCC2=O.
What is the InChIKey of 1-(dimethylamino)-6,7-dihydro-5H-indol-4-one?
The InChIKey is LLATTXKETJPRRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O/c1-11(2)12-7-6-8-9(12)4-3-5-10(8)13/h6-7H,3-5H2,1-2H3.
What are the key properties of 1-(dimethylamino)-6,7-dihydro-5H-indol-4-one?
1-(dimethylamino)-6,7-dihydro-5H-indol-4-one has a molecular weight of 178.24 g/mol, XLogP of 1.20, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(dimethylamino)-6,7-dihydro-5H-indol-4-one is sourced from PubChem (CID 83023680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).