C8H12N4O — CID 83024659
2-amino-N',N'-dimethylpyridine-3-carbohydrazide (PubChem CID 83024659) has the molecular formula C8H12N4O and a molecular weight of 180.21 g/mol. Its IUPAC name is 2-amino-N',N'-dimethylpyridine-3-carbohydrazide.
| Compound Name | 2-amino-N',N'-dimethylpyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 83024659 |
| Molecular Formula | C8H12N4O |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.10 |
| IUPAC Name | 2-amino-N',N'-dimethylpyridine-3-carbohydrazide |
| SMILES | CN(C)NC(=O)c1cccnc1N |
| InChI | InChI=1S/C8H12N4O/c1-12(2)11-8(13)6-4-3-5-10-7(6)9/h3-5H,1-2H3,(H2,9,10)(H,11,13) |
| InChIKey | GIWBPCQFFUMPBN-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|