C11H21N5 — CID 83024839
2-tert-butyl-6-(2,2-dimethylhydrazinyl)-N-methylpyrimidin-4-amine (PubChem CID 83024839) has the molecular formula C11H21N5 and a molecular weight of 223.32 g/mol. Its IUPAC name is 2-tert-butyl-6-(2,2-dimethylhydrazinyl)-N-methylpyrimidin-4-amine.
| Compound Name | 2-tert-butyl-6-(2,2-dimethylhydrazinyl)-N-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 83024839 |
| Molecular Formula | C11H21N5 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.18 |
| IUPAC Name | 2-tert-butyl-6-(2,2-dimethylhydrazinyl)-N-methylpyrimidin-4-amine |
| SMILES | CNc1cc(NN(C)C)nc(C(C)(C)C)n1 |
| InChI | InChI=1S/C11H21N5/c1-11(2,3)10-13-8(12-4)7-9(14-10)15-16(5)6/h7H,1-6H3,(H2,12,13,14,15) |
| InChIKey | JNFZJFPSOPPRLH-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|