C9H14N6 — CID 83024847
8-(2,2-dimethylhydrazinyl)-N-methylimidazo[1,2-a]pyrazin-6-amine (PubChem CID 83024847) has the molecular formula C9H14N6 and a molecular weight of 206.25 g/mol. Its IUPAC name is 8-(2,2-dimethylhydrazinyl)-N-methylimidazo[1,2-a]pyrazin-6-amine.
| Compound Name | 8-(2,2-dimethylhydrazinyl)-N-methylimidazo[1,2-a]pyrazin-6-amine |
|---|---|
| PubChem CID | 83024847 |
| Molecular Formula | C9H14N6 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | 8-(2,2-dimethylhydrazinyl)-N-methylimidazo[1,2-a]pyrazin-6-amine |
| SMILES | CNc1cn2ccnc2c(NN(C)C)n1 |
| InChI | InChI=1S/C9H14N6/c1-10-7-6-15-5-4-11-9(15)8(12-7)13-14(2)3/h4-6,10H,1-3H3,(H,12,13) |
| InChIKey | YCYGZNJPVSMGRJ-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 57.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|