C13H20ClN5O — CID 83024967
3-chloro-6-(ethylamino)-N-(4-methylpiperazin-1-yl)pyridine-2-carboxamide (PubChem CID 83024967) has the molecular formula C13H20ClN5O and a molecular weight of 297.79 g/mol. Its IUPAC name is 3-chloro-6-(ethylamino)-N-(4-methylpiperazin-1-yl)pyridine-2-carboxamide.
| Compound Name | 3-chloro-6-(ethylamino)-N-(4-methylpiperazin-1-yl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 83024967 |
| Molecular Formula | C13H20ClN5O |
| Molecular Weight | 297.79 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | 3-chloro-6-(ethylamino)-N-(4-methylpiperazin-1-yl)pyridine-2-carboxamide |
| SMILES | CCNc1ccc(Cl)c(C(=O)NN2CCN(C)CC2)n1 |
| InChI | InChI=1S/C13H20ClN5O/c1-3-15-11-5-4-10(14)12(16-11)13(20)17-19-8-6-18(2)7-9-19/h4-5H,3,6-9H2,1-2H3,(H,15,16)(H,17,20) |
| InChIKey | WJGSFDRRVIURBL-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 60.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.79 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |