C11H15N5OS — CID 83025023
5-amino-N',N',3,4-tetramethylthieno[2,3-c]pyridazine-6-carbohydrazide (PubChem CID 83025023) has the molecular formula C11H15N5OS and a molecular weight of 265.34 g/mol. Its IUPAC name is 5-amino-N',N',3,4-tetramethylthieno[2,3-c]pyridazine-6-carbohydrazide.
| Compound Name | 5-amino-N',N',3,4-tetramethylthieno[2,3-c]pyridazine-6-carbohydrazide |
|---|---|
| PubChem CID | 83025023 |
| Molecular Formula | C11H15N5OS |
| Molecular Weight | 265.34 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | 5-amino-N',N',3,4-tetramethylthieno[2,3-c]pyridazine-6-carbohydrazide |
| SMILES | Cc1nnc2sc(C(=O)NN(C)C)c(N)c2c1C |
| InChI | InChI=1S/C11H15N5OS/c1-5-6(2)13-14-11-7(5)8(12)9(18-11)10(17)15-16(3)4/h12H2,1-4H3,(H,15,17) |
| InChIKey | VVBACWNYHXSEOP-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.34 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|