C7H10FN3 — CID 83025628
2-(5-fluoro-2-pyridinyl)-1,1-dimethylhydrazine (PubChem CID 83025628) has the molecular formula C7H10FN3 and a molecular weight of 155.18 g/mol. Its IUPAC name is 2-(5-fluoro-2-pyridinyl)-1,1-dimethylhydrazine.
| Compound Name | 2-(5-fluoro-2-pyridinyl)-1,1-dimethylhydrazine |
|---|---|
| PubChem CID | 83025628 |
| Molecular Formula | C7H10FN3 |
| Molecular Weight | 155.18 g/mol |
| Exact Mass | 155.09 |
| IUPAC Name | 2-(5-fluoro-2-pyridinyl)-1,1-dimethylhydrazine |
| SMILES | CN(C)Nc1ccc(F)cn1 |
| InChI | InChI=1S/C7H10FN3/c1-11(2)10-7-4-3-6(8)5-9-7/h3-5H,1-2H3,(H,9,10) |
| InChIKey | DTGDZUALIWRCSG-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.18 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|