C7H10N4O2 — CID 83025826
1,1-dimethyl-2-(4-nitro-2-pyridinyl)hydrazine (PubChem CID 83025826) has the molecular formula C7H10N4O2 and a molecular weight of 182.18 g/mol. Its IUPAC name is 1,1-dimethyl-2-(4-nitro-2-pyridinyl)hydrazine.
| Compound Name | 1,1-dimethyl-2-(4-nitro-2-pyridinyl)hydrazine |
|---|---|
| PubChem CID | 83025826 |
| Molecular Formula | C7H10N4O2 |
| Molecular Weight | 182.18 g/mol |
| Exact Mass | 182.08 |
| IUPAC Name | 1,1-dimethyl-2-(4-nitro-2-pyridinyl)hydrazine |
| SMILES | CN(C)Nc1cc([N+](=O)[O-])ccn1 |
| InChI | InChI=1S/C7H10N4O2/c1-10(2)9-7-5-6(11(12)13)3-4-8-7/h3-5H,1-2H3,(H,8,9) |
| InChIKey | MEJLVQMLKAGLHC-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 71.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.18 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|