C10H14ClN3 — CID 83026137
5-chloro-N-piperidin-1-ylpyridin-2-amine (PubChem CID 83026137) has the molecular formula C10H14ClN3 and a molecular weight of 211.70 g/mol. Its IUPAC name is 5-chloro-N-piperidin-1-ylpyridin-2-amine.
| Compound Name | 5-chloro-N-piperidin-1-ylpyridin-2-amine |
|---|---|
| PubChem CID | 83026137 |
| Molecular Formula | C10H14ClN3 |
| Molecular Weight | 211.70 g/mol |
| Exact Mass | 211.09 |
| IUPAC Name | 5-chloro-N-piperidin-1-ylpyridin-2-amine |
| SMILES | Clc1ccc(NN2CCCCC2)nc1 |
| InChI | InChI=1S/C10H14ClN3/c11-9-4-5-10(12-8-9)13-14-6-2-1-3-7-14/h4-5,8H,1-3,6-7H2,(H,12,13) |
| InChIKey | BBVVONOQBIEIQU-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.70 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |