C11H17N3O2S — CID 83026660
N',N'-dimethyl-1,2,3,4-tetrahydroquinoline-6-sulfonohydrazide (PubChem CID 83026660) has the molecular formula C11H17N3O2S and a molecular weight of 255.34 g/mol. Its IUPAC name is N',N'-dimethyl-1,2,3,4-tetrahydroquinoline-6-sulfonohydrazide.
| Compound Name | N',N'-dimethyl-1,2,3,4-tetrahydroquinoline-6-sulfonohydrazide |
|---|---|
| PubChem CID | 83026660 |
| Molecular Formula | C11H17N3O2S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | N',N'-dimethyl-1,2,3,4-tetrahydroquinoline-6-sulfonohydrazide |
| SMILES | CN(C)NS(=O)(=O)c1ccc2c(c1)CCCN2 |
| InChI | InChI=1S/C11H17N3O2S/c1-14(2)13-17(15,16)10-5-6-11-9(8-10)4-3-7-12-11/h5-6,8,12-13H,3-4,7H2,1-2H3 |
| InChIKey | YOODJEJNSINMPW-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|