About (4-piperidin-1-yl-1,2,4-triazol-3-yl)methanol
(4-piperidin-1-yl-1,2,4-triazol-3-yl)methanol (PubChem CID 83026916) has the molecular formula C8H14N4O
and a molecular weight of 182.23 g/mol. Its IUPAC name is (4-piperidin-1-yl-1,2,4-triazol-3-yl)methanol.
Molecular Properties
| Compound Name | (4-piperidin-1-yl-1,2,4-triazol-3-yl)methanol |
| PubChem CID | 83026916 |
| Molecular Formula | C8H14N4O |
| Molecular Weight | 182.23 g/mol |
| Exact Mass | 182.12 |
| IUPAC Name | (4-piperidin-1-yl-1,2,4-triazol-3-yl)methanol |
| SMILES | OCc1nncn1N1CCCCC1 |
| InChI | InChI=1S/C8H14N4O/c13-6-8-10-9-7-12(8)11-4-2-1-3-5-11/h7,13H,1-6H2 |
| InChIKey | WSLVYESMAICDOA-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.23 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (4-piperidin-1-yl-1,2,4-triazol-3-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-piperidin-1-yl-1,2,4-triazol-3-yl)methanol?
The IUPAC name of (4-piperidin-1-yl-1,2,4-triazol-3-yl)methanol (CID 83026916) is (4-piperidin-1-yl-1,2,4-triazol-3-yl)methanol.
What is the SMILES notation for (4-piperidin-1-yl-1,2,4-triazol-3-yl)methanol?
The canonical SMILES for (4-piperidin-1-yl-1,2,4-triazol-3-yl)methanol is OCc1nncn1N1CCCCC1.
What is the InChIKey of (4-piperidin-1-yl-1,2,4-triazol-3-yl)methanol?
The InChIKey is WSLVYESMAICDOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N4O/c13-6-8-10-9-7-12(8)11-4-2-1-3-5-11/h7,13H,1-6H2.
What are the key properties of (4-piperidin-1-yl-1,2,4-triazol-3-yl)methanol?
(4-piperidin-1-yl-1,2,4-triazol-3-yl)methanol has a molecular weight of 182.23 g/mol, XLogP of -0.11, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-piperidin-1-yl-1,2,4-triazol-3-yl)methanol is sourced from PubChem (CID 83026916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).