C14H24N4O — CID 83026937
6-N-(2,2-diethyloxan-4-yl)pyridine-2,3,6-triamine (PubChem CID 83026937) has the molecular formula C14H24N4O and a molecular weight of 264.37 g/mol. Its IUPAC name is 6-N-(2,2-diethyloxan-4-yl)pyridine-2,3,6-triamine.
| Compound Name | 6-N-(2,2-diethyloxan-4-yl)pyridine-2,3,6-triamine |
|---|---|
| PubChem CID | 83026937 |
| Molecular Formula | C14H24N4O |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.20 |
| IUPAC Name | 6-N-(2,2-diethyloxan-4-yl)pyridine-2,3,6-triamine |
| SMILES | CCC1(CC)CC(Nc2ccc(N)c(N)n2)CCO1 |
| InChI | InChI=1S/C14H24N4O/c1-3-14(4-2)9-10(7-8-19-14)17-12-6-5-11(15)13(16)18-12/h5-6,10H,3-4,7-9,15H2,1-2H3,(H3,16,17,18) |
| InChIKey | BZDLMSSYAICLGO-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 86.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |