About 4-(2,2-dimethylhydrazinyl)-1H-pyrazolo[5,4-d]pyrimidin-6-amine
4-(2,2-dimethylhydrazinyl)-1H-pyrazolo[5,4-d]pyrimidin-6-amine (PubChem CID 83026942) has the molecular formula C7H11N7
and a molecular weight of 193.21 g/mol. Its IUPAC name is 4-(2,2-dimethylhydrazinyl)-1H-pyrazolo[5,4-d]pyrimidin-6-amine.
Molecular Properties
| Compound Name | 4-(2,2-dimethylhydrazinyl)-1H-pyrazolo[5,4-d]pyrimidin-6-amine |
| PubChem CID | 83026942 |
| Molecular Formula | C7H11N7 |
| Molecular Weight | 193.21 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | 4-(2,2-dimethylhydrazinyl)-1H-pyrazolo[5,4-d]pyrimidin-6-amine |
| SMILES | CN(C)Nc1nc(N)nc2[nH]ncc12 |
| InChI | InChI=1S/C7H11N7/c1-14(2)13-6-4-3-9-12-5(4)10-7(8)11-6/h3H,1-2H3,(H4,8,9,10,11,12,13) |
| InChIKey | MKVFFFLPDQYUNF-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 95.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.21 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(2,2-dimethylhydrazinyl)-1H-pyrazolo[5,4-d]pyrimidin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,2-dimethylhydrazinyl)-1H-pyrazolo[5,4-d]pyrimidin-6-amine?
The IUPAC name of 4-(2,2-dimethylhydrazinyl)-1H-pyrazolo[5,4-d]pyrimidin-6-amine (CID 83026942) is 4-(2,2-dimethylhydrazinyl)-1H-pyrazolo[5,4-d]pyrimidin-6-amine.
What is the SMILES notation for 4-(2,2-dimethylhydrazinyl)-1H-pyrazolo[5,4-d]pyrimidin-6-amine?
The canonical SMILES for 4-(2,2-dimethylhydrazinyl)-1H-pyrazolo[5,4-d]pyrimidin-6-amine is CN(C)Nc1nc(N)nc2[nH]ncc12.
What is the InChIKey of 4-(2,2-dimethylhydrazinyl)-1H-pyrazolo[5,4-d]pyrimidin-6-amine?
The InChIKey is MKVFFFLPDQYUNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N7/c1-14(2)13-6-4-3-9-12-5(4)10-7(8)11-6/h3H,1-2H3,(H4,8,9,10,11,12,13).
What are the key properties of 4-(2,2-dimethylhydrazinyl)-1H-pyrazolo[5,4-d]pyrimidin-6-amine?
4-(2,2-dimethylhydrazinyl)-1H-pyrazolo[5,4-d]pyrimidin-6-amine has a molecular weight of 193.21 g/mol, XLogP of -0.18, 2 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,2-dimethylhydrazinyl)-1H-pyrazolo[5,4-d]pyrimidin-6-amine is sourced from PubChem (CID 83026942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).