C10H19N5 — CID 83026946
6-(2,2-dimethylhydrazinyl)-2-ethyl-N,5-dimethylpyrimidin-4-amine (PubChem CID 83026946) has the molecular formula C10H19N5 and a molecular weight of 209.30 g/mol. Its IUPAC name is 6-(2,2-dimethylhydrazinyl)-2-ethyl-N,5-dimethylpyrimidin-4-amine.
| Compound Name | 6-(2,2-dimethylhydrazinyl)-2-ethyl-N,5-dimethylpyrimidin-4-amine |
|---|---|
| PubChem CID | 83026946 |
| Molecular Formula | C10H19N5 |
| Molecular Weight | 209.30 g/mol |
| Exact Mass | 209.16 |
| IUPAC Name | 6-(2,2-dimethylhydrazinyl)-2-ethyl-N,5-dimethylpyrimidin-4-amine |
| SMILES | CCc1nc(NC)c(C)c(NN(C)C)n1 |
| InChI | InChI=1S/C10H19N5/c1-6-8-12-9(11-3)7(2)10(13-8)14-15(4)5/h6H2,1-5H3,(H2,11,12,13,14) |
| InChIKey | OQKZCLVLMRRBPR-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.30 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|