About 2-(5-fluoro-2-hydrazinylpyrimidin-4-yl)-1,1-dimethylhydrazine
2-(5-fluoro-2-hydrazinylpyrimidin-4-yl)-1,1-dimethylhydrazine (PubChem CID 83026990) has the molecular formula C6H11FN6
and a molecular weight of 186.19 g/mol. Its IUPAC name is 2-(5-fluoro-2-hydrazinylpyrimidin-4-yl)-1,1-dimethylhydrazine.
Molecular Properties
| Compound Name | 2-(5-fluoro-2-hydrazinylpyrimidin-4-yl)-1,1-dimethylhydrazine |
| PubChem CID | 83026990 |
| Molecular Formula | C6H11FN6 |
| Molecular Weight | 186.19 g/mol |
| Exact Mass | 186.10 |
| IUPAC Name | 2-(5-fluoro-2-hydrazinylpyrimidin-4-yl)-1,1-dimethylhydrazine |
| SMILES | CN(C)Nc1nc(NN)ncc1F |
| InChI | InChI=1S/C6H11FN6/c1-13(2)12-5-4(7)3-9-6(10-5)11-8/h3H,8H2,1-2H3,(H2,9,10,11,12) |
| InChIKey | HLYGCWABXTXBRK-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 79.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.19 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(5-fluoro-2-hydrazinylpyrimidin-4-yl)-1,1-dimethylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-fluoro-2-hydrazinylpyrimidin-4-yl)-1,1-dimethylhydrazine?
The IUPAC name of 2-(5-fluoro-2-hydrazinylpyrimidin-4-yl)-1,1-dimethylhydrazine (CID 83026990) is 2-(5-fluoro-2-hydrazinylpyrimidin-4-yl)-1,1-dimethylhydrazine.
What is the SMILES notation for 2-(5-fluoro-2-hydrazinylpyrimidin-4-yl)-1,1-dimethylhydrazine?
The canonical SMILES for 2-(5-fluoro-2-hydrazinylpyrimidin-4-yl)-1,1-dimethylhydrazine is CN(C)Nc1nc(NN)ncc1F.
What is the InChIKey of 2-(5-fluoro-2-hydrazinylpyrimidin-4-yl)-1,1-dimethylhydrazine?
The InChIKey is HLYGCWABXTXBRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11FN6/c1-13(2)12-5-4(7)3-9-6(10-5)11-8/h3H,8H2,1-2H3,(H2,9,10,11,12).
What are the key properties of 2-(5-fluoro-2-hydrazinylpyrimidin-4-yl)-1,1-dimethylhydrazine?
2-(5-fluoro-2-hydrazinylpyrimidin-4-yl)-1,1-dimethylhydrazine has a molecular weight of 186.19 g/mol, XLogP of -0.21, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-fluoro-2-hydrazinylpyrimidin-4-yl)-1,1-dimethylhydrazine is sourced from PubChem (CID 83026990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).