C13H17N5O — CID 83027065
2-N-methyl-4-N-morpholin-4-ylquinazoline-2,4-diamine (PubChem CID 83027065) has the molecular formula C13H17N5O and a molecular weight of 259.31 g/mol. Its IUPAC name is 2-N-methyl-4-N-morpholin-4-ylquinazoline-2,4-diamine.
| Compound Name | 2-N-methyl-4-N-morpholin-4-ylquinazoline-2,4-diamine |
|---|---|
| PubChem CID | 83027065 |
| Molecular Formula | C13H17N5O |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 2-N-methyl-4-N-morpholin-4-ylquinazoline-2,4-diamine |
| SMILES | CNc1nc(NN2CCOCC2)c2ccccc2n1 |
| InChI | InChI=1S/C13H17N5O/c1-14-13-15-11-5-3-2-4-10(11)12(16-13)17-18-6-8-19-9-7-18/h2-5H,6-9H2,1H3,(H2,14,15,16,17) |
| InChIKey | DJDBSDFJFHILDN-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 62.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |