About 2-cyclopropyl-4-N-(2,6-dimethylpiperidin-1-yl)pyrimidine-4,6-diamine
2-cyclopropyl-4-N-(2,6-dimethylpiperidin-1-yl)pyrimidine-4,6-diamine (PubChem CID 83027612) has the molecular formula C14H23N5
and a molecular weight of 261.37 g/mol. Its IUPAC name is 2-cyclopropyl-4-N-(2,6-dimethylpiperidin-1-yl)pyrimidine-4,6-diamine.
Molecular Properties
| Compound Name | 2-cyclopropyl-4-N-(2,6-dimethylpiperidin-1-yl)pyrimidine-4,6-diamine |
| PubChem CID | 83027612 |
| Molecular Formula | C14H23N5 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.20 |
| IUPAC Name | 2-cyclopropyl-4-N-(2,6-dimethylpiperidin-1-yl)pyrimidine-4,6-diamine |
| SMILES | CC1CCCC(C)N1Nc1cc(N)nc(C2CC2)n1 |
| InChI | InChI=1S/C14H23N5/c1-9-4-3-5-10(2)19(9)18-13-8-12(15)16-14(17-13)11-6-7-11/h8-11H,3-7H2,1-2H3,(H3,15,16,17,18) |
| InChIKey | NIAUVBIBQGJEKS-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-cyclopropyl-4-N-(2,6-dimethylpiperidin-1-yl)pyrimidine-4,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropyl-4-N-(2,6-dimethylpiperidin-1-yl)pyrimidine-4,6-diamine?
The IUPAC name of 2-cyclopropyl-4-N-(2,6-dimethylpiperidin-1-yl)pyrimidine-4,6-diamine (CID 83027612) is 2-cyclopropyl-4-N-(2,6-dimethylpiperidin-1-yl)pyrimidine-4,6-diamine.
What is the SMILES notation for 2-cyclopropyl-4-N-(2,6-dimethylpiperidin-1-yl)pyrimidine-4,6-diamine?
The canonical SMILES for 2-cyclopropyl-4-N-(2,6-dimethylpiperidin-1-yl)pyrimidine-4,6-diamine is CC1CCCC(C)N1Nc1cc(N)nc(C2CC2)n1.
What is the InChIKey of 2-cyclopropyl-4-N-(2,6-dimethylpiperidin-1-yl)pyrimidine-4,6-diamine?
The InChIKey is NIAUVBIBQGJEKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23N5/c1-9-4-3-5-10(2)19(9)18-13-8-12(15)16-14(17-13)11-6-7-11/h8-11H,3-7H2,1-2H3,(H3,15,16,17,18).
What are the key properties of 2-cyclopropyl-4-N-(2,6-dimethylpiperidin-1-yl)pyrimidine-4,6-diamine?
2-cyclopropyl-4-N-(2,6-dimethylpiperidin-1-yl)pyrimidine-4,6-diamine has a molecular weight of 261.37 g/mol, XLogP of 2.53, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropyl-4-N-(2,6-dimethylpiperidin-1-yl)pyrimidine-4,6-diamine is sourced from PubChem (CID 83027612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).