C14H26N2O4 — CID 83028212
2-[(2,2-diethyloxan-4-yl)carbamoylamino]butanoic acid (PubChem CID 83028212) has the molecular formula C14H26N2O4 and a molecular weight of 286.37 g/mol. Its IUPAC name is 2-[(2,2-diethyloxan-4-yl)carbamoylamino]butanoic acid.
| Compound Name | 2-[(2,2-diethyloxan-4-yl)carbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 83028212 |
| Molecular Formula | C14H26N2O4 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | 2-[(2,2-diethyloxan-4-yl)carbamoylamino]butanoic acid |
| SMILES | CCC(NC(=O)NC1CCOC(CC)(CC)C1)C(=O)O |
| InChI | InChI=1S/C14H26N2O4/c1-4-11(12(17)18)16-13(19)15-10-7-8-20-14(5-2,6-3)9-10/h10-11H,4-9H2,1-3H3,(H,17,18)(H2,15,16,19) |
| InChIKey | JFQNGFHBVWPVAA-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |